ChemNet > CAS > 138666-59-8 1,8-Diazabicyclo[5.4.0]undec-7-ene hydrotribromide
138666-59-8 1,8-Diazabicyclo[5.4.0]undec-7-ene hydrotribromide
اسم المنتج |
1,8-Diazabicyclo[5.4.0]undec-7-ene hydrotribromide |
الاسم المستعار |
DBUHBr_3; 1,8-Diazabicyclo[5.4.0]undec-7-ene hydrobromide perbromide |
الصيغة الجزيئية |
C9H17Br3N2 |
الوزن الجزيئي الغرامي |
392.95668 |
InChI |
InChI=1/C9H16N2.Br3/c1-2-5-9-10-6-4-8-11(9)7-3-1;1-3-2/h1-8H2;/q;-1/p+1 |
إستراتيجية المساعدة القطرية |
138666-59-8 |
بنية جزيئية |
|
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|